Description
Anastrozole Research Chemical
Anastrozole binds to the aromatase enzyme as well as acts through inhibition and blocks the androgen conversion to estrogens within peripheral (extra-gonadal) tissues. It is sold in a 1 mg per ml 30 ml solution per bottle. It is the active ingredient in Arimidex, a prescription Aromatase inhibitor or Antiestrogen medication by the USA pharmaceutical company Astrazeneca.
Chemical Information
Clinical data |
|
| Trade names | Arimidex, Adex |
| Drug class | Aromatase inhibitor; Antiestrogen |
| MedlinePlus | a696018 |
| AHFS/Drugs.com | Monograph |
| Pregnancy category |
US: D (Evidence of risk) |
| License data | US FDA: Anastrozole |
| ATC code | L02BG03 (WHO) |
Pharmacokinetic data |
|
| Bioavailability | 83–85% |
| Metabolism | Liver (85%) |
| Protein binding | 40% |
| Excretion | Urine (11%) |
| half-life | 46.8 hours[2] |
Identifiers |
|
| CAS Number | 120511-73-1 |
| ChemSpider | 2102 |
| IUPAC name | 2,2′-[5-(1H-1,2,4-triazol-1-ylmethyl)-1,3-phenylene]bis(2-methylpropanenitrile)[3] |
| PubChem CID | 2187 |
| IUPHAR/BPS | 5137 |
| DrugBank | DB01217 |
| UNII | 2Z07MYW1AZ |
| KEGG | D00960 |
| ChEBI | CHEBI:2704 |
| ChEMBL | ChEMBL1399 |
| ECHA InfoCard | 100.129.723 |
Legal Status |
|
| Legal status | US: ℞-only
UK: POM (Prescription only) |
Chemical and physical data |
|
| Formula | C17H19N5 |
| InChI | InChI=1S/C17H19N5/c1-16(2,9-18)14-5-13(8-22-12-20-11-21-22)6-15(7-14)17(3,4)10-19/h5-7,11-12H,8H2,1-4H3
Key:YBBLVLTVTVSKRW-UHFFFAOYSA-N |
| Molar mass | 293.366 g/mol |
| SMILES | N#CC(C)(C)c1cc(Cn2cncn2)cc(c1)C(C)(C)C#N |
Where can you buy Anastrozole Online?
You can buy Adex online as a research chemical for research purposes only and never for human consumption from Top Peptides.
